C13H10ClN3O5 — CID 5048192
5-[(2-chloro-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 5048192) has the molecular formula C13H10ClN3O5 and a molecular weight of 323.69 g/mol. Its IUPAC name is 5-[(2-chloro-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2-chloro-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5048192 |
| Molecular Formula | C13H10ClN3O5 |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 5-[(2-chloro-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2cc([N+](=O)[O-])ccc2Cl)C(=O)N(C)C1=O |
| InChI | InChI=1S/C13H10ClN3O5/c1-15-11(18)9(12(19)16(2)13(15)20)6-7-5-8(17(21)22)3-4-10(7)14/h3-6H,1-2H3 |
| InChIKey | KJTIXMGARXVJBL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|