C14H19N7O4 — CID 135446686
1-[(E)-[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-2-nitroguanidine (PubChem CID 135446686) has the molecular formula C14H19N7O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-[(E)-[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-2-nitroguanidine.
| Compound Name | 1-[(E)-[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135446686 |
| Molecular Formula | C14H19N7O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-[(E)-[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methylideneamino]-2-nitroguanidine |
| SMILES | CC1CCN(c2ccc(/C=N/N/C(N)=N\[N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H19N7O4/c1-10-4-6-19(7-5-10)12-3-2-11(8-13(12)20(22)23)9-16-17-14(15)18-21(24)25/h2-3,8-10H,4-7H2,1H3,(H3,15,17,18)/b16-9+ |
| InChIKey | DSUGSCOWODYUSZ-CXUHLZMHSA-N |
| XLogP | 1.26 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|