C16H20N8O3S — CID 6246804
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]acetamide (PubChem CID 6246804) has the molecular formula C16H20N8O3S and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6246804 |
| Molecular Formula | C16H20N8O3S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylideneamino]acetamide |
| SMILES | CN1CCN(c2ccc(/C=N\NC(=O)Cc3nnc(N)s3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H20N8O3S/c1-22-4-6-23(7-5-22)12-3-2-11(8-13(12)24(26)27)10-18-19-14(25)9-15-20-21-16(17)28-15/h2-3,8,10H,4-7,9H2,1H3,(H2,17,21)(H,19,25)/b18-10- |
| InChIKey | RQFSODGSOBQVES-ZDLGFXPLSA-N |
| XLogP | 0.47 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|