C11H10N6O4S — CID 135521461
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 135521461) has the molecular formula C11H10N6O4S and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135521461 |
| Molecular Formula | C11H10N6O4S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | Nc1nnc(CC(=O)N/N=C\c2cc([N+](=O)[O-])ccc2O)s1 |
| InChI | InChI=1S/C11H10N6O4S/c12-11-16-15-10(22-11)4-9(19)14-13-5-6-3-7(17(20)21)1-2-8(6)18/h1-3,5,18H,4H2,(H2,12,16)(H,14,19)/b13-5- |
| InChIKey | OCRDEAMLLVDZKT-ACAGNQJTSA-N |
| XLogP | 0.43 |
| TPSA | 156.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|