C23H31N3O2 — CID 91674493
4-butyl-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methyl]aniline (PubChem CID 91674493) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-butyl-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methyl]aniline.
| Compound Name | 4-butyl-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methyl]aniline |
|---|---|
| PubChem CID | 91674493 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-butyl-N-[[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]methyl]aniline |
| SMILES | CCCCc1ccc(NCc2ccc(N3CCC(C)CC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-3-4-5-19-6-9-21(10-7-19)24-17-20-8-11-22(23(16-20)26(27)28)25-14-12-18(2)13-15-25/h6-11,16,18,24H,3-5,12-15,17H2,1-2H3 |
| InChIKey | YLTXZCDOEVLCBY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|