C17H13N3O3S — CID 10593164
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(1,2-benzothiazol-3-yl)acetamide (PubChem CID 10593164) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(1,2-benzothiazol-3-yl)acetamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(1,2-benzothiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 10593164 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(1,2-benzothiazol-3-yl)acetamide |
| SMILES | O=C(Cc1nsc2ccccc12)N/N=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13N3O3S/c21-17(8-13-12-3-1-2-4-16(12)24-20-13)19-18-9-11-5-6-14-15(7-11)23-10-22-14/h1-7,9H,8,10H2,(H,19,21)/b18-9+ |
| InChIKey | CHUQQTNVYTXZGS-GIJQJNRQSA-N |
| XLogP | 2.72 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|