C24H19N3O2 — CID 94849417
1-(1,3-benzodioxol-5-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanimine (PubChem CID 94849417) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanimine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanimine |
|---|---|
| PubChem CID | 94849417 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[1-(4-methylphenyl)-3-phenylpyrazol-5-yl]methanimine |
| SMILES | Cc1ccc(-n2nc(-c3ccccc3)cc2N=Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C24H19N3O2/c1-17-7-10-20(11-8-17)27-24(14-21(26-27)19-5-3-2-4-6-19)25-15-18-9-12-22-23(13-18)29-16-28-22/h2-15H,16H2,1H3 |
| InChIKey | DIORQPQNXSBCIM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|