C23H16F3N3 — CID 126057753
N-(1,3-diphenylpyrazol-5-yl)-1-[2-(trifluoromethyl)phenyl]methanimine (PubChem CID 126057753) has the molecular formula C23H16F3N3 and a molecular weight of 391.40 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-1-[2-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-1-[2-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 126057753 |
| Molecular Formula | C23H16F3N3 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-1-[2-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccccc1C=Nc1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H16F3N3/c24-23(25,26)20-14-8-7-11-18(20)16-27-22-15-21(17-9-3-1-4-10-17)28-29(22)19-12-5-2-6-13-19/h1-16H |
| InChIKey | KZDHXWAEOXXRHU-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|