C19H12F3N5O — CID 9462057
1-phenyl-5-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 9462057) has the molecular formula C19H12F3N5O and a molecular weight of 383.33 g/mol. Its IUPAC name is 1-phenyl-5-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-phenyl-5-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9462057 |
| Molecular Formula | C19H12F3N5O |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1-phenyl-5-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cnn(-c3ccccc3)c2ncn1/N=C\c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H12F3N5O/c20-19(21,22)16-9-5-4-6-13(16)10-24-26-12-23-17-15(18(26)28)11-25-27(17)14-7-2-1-3-8-14/h1-12H/b24-10- |
| InChIKey | RIQXYXGRVLLUIJ-VROXFSQNSA-N |
| XLogP | 3.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|