C23H23N3O4 — CID 123869250
diethyl 2-[(1,3-diphenylpyrazol-5-yl)iminomethyl]propanedioate (PubChem CID 123869250) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is diethyl 2-[(1,3-diphenylpyrazol-5-yl)iminomethyl]propanedioate.
| Compound Name | diethyl 2-[(1,3-diphenylpyrazol-5-yl)iminomethyl]propanedioate |
|---|---|
| PubChem CID | 123869250 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | diethyl 2-[(1,3-diphenylpyrazol-5-yl)iminomethyl]propanedioate |
| SMILES | CCOC(=O)C(C=Nc1cc(-c2ccccc2)nn1-c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C23H23N3O4/c1-3-29-22(27)19(23(28)30-4-2)16-24-21-15-20(17-11-7-5-8-12-17)25-26(21)18-13-9-6-10-14-18/h5-16,19H,3-4H2,1-2H3 |
| InChIKey | ASKBXVHLKIZUGZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|