C33H29N3O2 — CID 25250622
[3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate (PubChem CID 25250622) has the molecular formula C33H29N3O2 and a molecular weight of 499.61 g/mol. Its IUPAC name is [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate.
| Compound Name | [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 25250622 |
| Molecular Formula | C33H29N3O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2cccc(/C=N/c3cc(-c4ccccc4)nn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H29N3O2/c1-33(2,3)27-19-17-26(18-20-27)32(37)38-29-16-10-11-24(21-29)23-34-31-22-30(25-12-6-4-7-13-25)35-36(31)28-14-8-5-9-15-28/h4-23H,1-3H3/b34-23+ |
| InChIKey | RWVSPBNBARXAKM-PPFNPFNJSA-N |
| XLogP | 7.81 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|