About [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate
[3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate (PubChem CID 25250622) has the molecular formula C33H29N3O2
and a molecular weight of 499.61 g/mol. Its IUPAC name is [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate |
| PubChem CID | 25250622 |
| Molecular Formula | C33H29N3O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2cccc(/C=N/c3cc(-c4ccccc4)nn3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H29N3O2/c1-33(2,3)27-19-17-26(18-20-27)32(37)38-29-16-10-11-24(21-29)23-34-31-22-30(25-12-6-4-7-13-25)35-36(31)28-14-8-5-9-15-28/h4-23H,1-3H3/b34-23+ |
| InChIKey | RWVSPBNBARXAKM-PPFNPFNJSA-N |
| XLogP | 7.81 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate?
The IUPAC name of [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate (CID 25250622) is [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate.
What is the SMILES notation for [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate?
The canonical SMILES for [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate is CC(C)(C)c1ccc(C(=O)Oc2cccc(/C=N/c3cc(-c4ccccc4)nn3-c3ccccc3)c2)cc1.
What is the InChIKey of [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate?
The InChIKey is RWVSPBNBARXAKM-PPFNPFNJSA-N. The full InChI is InChI=1S/C33H29N3O2/c1-33(2,3)27-19-17-26(18-20-27)32(37)38-29-16-10-11-24(21-29)23-34-31-22-30(25-12-6-4-7-13-25)35-36(31)28-14-8-5-9-15-28/h4-23H,1-3H3/b34-23+.
What are the key properties of [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate?
[3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate has a molecular weight of 499.61 g/mol, XLogP of 7.81, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-(1,3-diphenylpyrazol-5-yl)iminomethyl]phenyl] 4-tert-butylbenzoate is sourced from PubChem (CID 25250622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).