C21H18N2O2 — CID 4241949
[3-(2,2-dicyanoethenyl)phenyl] 4-tert-butylbenzoate (PubChem CID 4241949) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is [3-(2,2-dicyanoethenyl)phenyl] 4-tert-butylbenzoate.
| Compound Name | [3-(2,2-dicyanoethenyl)phenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 4241949 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [3-(2,2-dicyanoethenyl)phenyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2cccc(C=C(C#N)C#N)c2)cc1 |
| InChI | InChI=1S/C21H18N2O2/c1-21(2,3)18-9-7-17(8-10-18)20(24)25-19-6-4-5-15(12-19)11-16(13-22)14-23/h4-12H,1-3H3 |
| InChIKey | CRCKSRUSCRSNIN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|