About [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate
[3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate (PubChem CID 19195097) has the molecular formula C25H19NO4
and a molecular weight of 397.43 g/mol. Its IUPAC name is [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate.
Molecular Properties
| Compound Name | [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate |
| PubChem CID | 19195097 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cccc(OC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H19NO4/c1-2-29-24(27)22(17-26)15-18-7-6-10-23(16-18)30-25(28)21-13-11-20(12-14-21)19-8-4-3-5-9-19/h3-16H,2H2,1H3/b22-15+ |
| InChIKey | UGBCZXFIKBYSMK-PXLXIMEGSA-N |
| XLogP | 5.04 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate?
The IUPAC name of [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate (CID 19195097) is [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate.
What is the SMILES notation for [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate?
The canonical SMILES for [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate is CCOC(=O)/C(C#N)=C/c1cccc(OC(=O)c2ccc(-c3ccccc3)cc2)c1.
What is the InChIKey of [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate?
The InChIKey is UGBCZXFIKBYSMK-PXLXIMEGSA-N. The full InChI is InChI=1S/C25H19NO4/c1-2-29-24(27)22(17-26)15-18-7-6-10-23(16-18)30-25(28)21-13-11-20(12-14-21)19-8-4-3-5-9-19/h3-16H,2H2,1H3/b22-15+.
What are the key properties of [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate?
[3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate has a molecular weight of 397.43 g/mol, XLogP of 5.04, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4-phenylbenzoate is sourced from PubChem (CID 19195097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).