C17H11Br2NO4S — CID 19197504
[3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4,5-dibromothiophene-2-carboxylate (PubChem CID 19197504) has the molecular formula C17H11Br2NO4S and a molecular weight of 485.15 g/mol. Its IUPAC name is [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19197504 |
| Molecular Formula | C17H11Br2NO4S |
| Molecular Weight | 485.15 g/mol |
| Exact Mass | 482.88 |
| IUPAC Name | [3-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenyl] 4,5-dibromothiophene-2-carboxylate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cccc(OC(=O)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C17H11Br2NO4S/c1-2-23-16(21)11(9-20)6-10-4-3-5-12(7-10)24-17(22)14-8-13(18)15(19)25-14/h3-8H,2H2,1H3/b11-6+ |
| InChIKey | FBPXUDSYPFPVLG-IZZDOVSWSA-N |
| XLogP | 4.96 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.15 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|