C25H25NO6 — CID 19195441
ethyl (E)-2-cyano-3-[3-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate (PubChem CID 19195441) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[3-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[3-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19195441 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | ethyl (E)-2-cyano-3-[3-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cccc(OC(=O)/C=C/c2ccc(OCC)c(OCC)c2)c1 |
| InChI | InChI=1S/C25H25NO6/c1-4-29-22-12-10-18(16-23(22)30-5-2)11-13-24(27)32-21-9-7-8-19(15-21)14-20(17-26)25(28)31-6-3/h7-16H,4-6H2,1-3H3/b13-11+,20-14+ |
| InChIKey | ANRYBALTKYHNEK-WRMRRPGHSA-N |
| XLogP | 4.57 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|