C22H17Cl2NO5 — CID 19177699
ethyl (E)-2-cyano-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]oxy-3-methoxyphenyl]prop-2-enoate (PubChem CID 19177699) has the molecular formula C22H17Cl2NO5 and a molecular weight of 446.29 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]oxy-3-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]oxy-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19177699 |
| Molecular Formula | C22H17Cl2NO5 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[(E)-3-(2,6-dichlorophenyl)prop-2-enoyl]oxy-3-methoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(OC(=O)/C=C/c2c(Cl)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H17Cl2NO5/c1-3-29-22(27)15(13-25)11-14-7-9-19(20(12-14)28-2)30-21(26)10-8-16-17(23)5-4-6-18(16)24/h4-12H,3H2,1-2H3/b10-8+,15-11+ |
| InChIKey | VQLABVMEXBSOCD-WSZGUFMCSA-N |
| XLogP | 5.09 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|