C28H20BrN5O4S — CID 4063437
6-bromo-N-[[4-(4-methylphenyl)sulfonyl-3-nitrophenyl]methylideneamino]-4-phenylquinazolin-2-amine (PubChem CID 4063437) has the molecular formula C28H20BrN5O4S and a molecular weight of 602.47 g/mol. Its IUPAC name is 6-bromo-N-[[4-(4-methylphenyl)sulfonyl-3-nitrophenyl]methylideneamino]-4-phenylquinazolin-2-amine.
| Compound Name | 6-bromo-N-[[4-(4-methylphenyl)sulfonyl-3-nitrophenyl]methylideneamino]-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 4063437 |
| Molecular Formula | C28H20BrN5O4S |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.04 |
| IUPAC Name | 6-bromo-N-[[4-(4-methylphenyl)sulfonyl-3-nitrophenyl]methylideneamino]-4-phenylquinazolin-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C=NNc3nc(-c4ccccc4)c4cc(Br)ccc4n3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H20BrN5O4S/c1-18-7-11-22(12-8-18)39(37,38)26-14-9-19(15-25(26)34(35)36)17-30-33-28-31-24-13-10-21(29)16-23(24)27(32-28)20-5-3-2-4-6-20/h2-17H,1H3,(H,31,32,33) |
| InChIKey | FGAWIYLCQLTMQF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|