C24H21N5 — CID 98285469
N-[(Z)-[(3aR,7aS)-3a,7a-dihydro-1H-indol-2-yl]methylideneamino]-6-methyl-4-phenylquinazolin-2-amine (PubChem CID 98285469) has the molecular formula C24H21N5 and a molecular weight of 379.47 g/mol. Its IUPAC name is N-[(Z)-[(3aR,7aS)-3a,7a-dihydro-1H-indol-2-yl]methylideneamino]-6-methyl-4-phenylquinazolin-2-amine.
| Compound Name | N-[(Z)-[(3aR,7aS)-3a,7a-dihydro-1H-indol-2-yl]methylideneamino]-6-methyl-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 98285469 |
| Molecular Formula | C24H21N5 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[(Z)-[(3aR,7aS)-3a,7a-dihydro-1H-indol-2-yl]methylideneamino]-6-methyl-4-phenylquinazolin-2-amine |
| SMILES | Cc1ccc2nc(N/N=C\C3=C[C@H]4C=CC=C[C@@H]4N3)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H21N5/c1-16-11-12-22-20(13-16)23(17-7-3-2-4-8-17)28-24(27-22)29-25-15-19-14-18-9-5-6-10-21(18)26-19/h2-15,18,21,26H,1H3,(H,27,28,29)/b25-15-/t18-,21+/m1/s1 |
| InChIKey | ZQRJEROSEGFKLN-QCXSIWTBSA-N |
| XLogP | 4.60 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|