C35H26BrClN4O3 — CID 6138931
2-[4-(6-bromo-4-phenylquinolin-2-yl)phenoxy]-N-[(Z)-(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]acetamide (PubChem CID 6138931) has the molecular formula C35H26BrClN4O3 and a molecular weight of 665.98 g/mol. Its IUPAC name is 2-[4-(6-bromo-4-phenylquinolin-2-yl)phenoxy]-N-[(Z)-(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[4-(6-bromo-4-phenylquinolin-2-yl)phenoxy]-N-[(Z)-(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6138931 |
| Molecular Formula | C35H26BrClN4O3 |
| Molecular Weight | 665.98 g/mol |
| Exact Mass | 664.09 |
| IUPAC Name | 2-[4-(6-bromo-4-phenylquinolin-2-yl)phenoxy]-N-[(Z)-(2-chloro-7-ethoxyquinolin-3-yl)methylideneamino]acetamide |
| SMILES | CCOc1ccc2cc(/C=N\NC(=O)COc3ccc(-c4cc(-c5ccccc5)c5cc(Br)ccc5n4)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C35H26BrClN4O3/c1-2-43-28-14-10-24-16-25(35(37)40-32(24)18-28)20-38-41-34(42)21-44-27-12-8-23(9-13-27)33-19-29(22-6-4-3-5-7-22)30-17-26(36)11-15-31(30)39-33/h3-20H,2,21H2,1H3,(H,41,42)/b38-20- |
| InChIKey | TZRZQQDMMQLDCK-KWQVAVEISA-N |
| XLogP | 8.46 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.98 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|