C32H26ClN3O4 — CID 75361373
2-[4-(6-chloro-4-phenylquinolin-2-yl)phenoxy]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 75361373) has the molecular formula C32H26ClN3O4 and a molecular weight of 552.03 g/mol. Its IUPAC name is 2-[4-(6-chloro-4-phenylquinolin-2-yl)phenoxy]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-(6-chloro-4-phenylquinolin-2-yl)phenoxy]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 75361373 |
| Molecular Formula | C32H26ClN3O4 |
| Molecular Weight | 552.03 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 2-[4-(6-chloro-4-phenylquinolin-2-yl)phenoxy]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)COc2ccc(-c3cc(-c4ccccc4)c4cc(Cl)ccc4n3)cc2)c(OC)c1 |
| InChI | InChI=1S/C32H26ClN3O4/c1-38-26-14-10-23(31(17-26)39-2)19-34-36-32(37)20-40-25-12-8-22(9-13-25)30-18-27(21-6-4-3-5-7-21)28-16-24(33)11-15-29(28)35-30/h3-19H,20H2,1-2H3,(H,36,37)/b34-19+ |
| InChIKey | ZTLXNPJPXXXHCO-ALQBTCKLSA-N |
| XLogP | 6.77 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.03 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|