C28H24ClN5O4 — CID 6001803
N'-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-N-[2-[(4-ethoxyphenyl)carbamoyl]phenyl]oxamide (PubChem CID 6001803) has the molecular formula C28H24ClN5O4 and a molecular weight of 529.98 g/mol. Its IUPAC name is N'-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-N-[2-[(4-ethoxyphenyl)carbamoyl]phenyl]oxamide.
| Compound Name | N'-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-N-[2-[(4-ethoxyphenyl)carbamoyl]phenyl]oxamide |
|---|---|
| PubChem CID | 6001803 |
| Molecular Formula | C28H24ClN5O4 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | N'-[(Z)-(2-chloro-7-methylquinolin-3-yl)methylideneamino]-N-[2-[(4-ethoxyphenyl)carbamoyl]phenyl]oxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=O)C(=O)N/N=C\c2cc3ccc(C)cc3nc2Cl)cc1 |
| InChI | InChI=1S/C28H24ClN5O4/c1-3-38-21-12-10-20(11-13-21)31-26(35)22-6-4-5-7-23(22)33-27(36)28(37)34-30-16-19-15-18-9-8-17(2)14-24(18)32-25(19)29/h4-16H,3H2,1-2H3,(H,31,35)(H,33,36)(H,34,37)/b30-16- |
| InChIKey | YBTCACLEBUKJEN-UHBFCERESA-N |
| XLogP | 4.94 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|