C25H18ClN5O2 — CID 135587487
2-[(6-chloro-4-phenylquinazolin-2-yl)amino]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 135587487) has the molecular formula C25H18ClN5O2 and a molecular weight of 455.91 g/mol. Its IUPAC name is 2-[(6-chloro-4-phenylquinazolin-2-yl)amino]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(6-chloro-4-phenylquinazolin-2-yl)amino]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135587487 |
| Molecular Formula | C25H18ClN5O2 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-[(6-chloro-4-phenylquinazolin-2-yl)amino]-4-(4-methoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(-c2cc(=O)[nH]c(Nc3nc(-c4ccccc4)c4cc(Cl)ccc4n3)n2)cc1 |
| InChI | InChI=1S/C25H18ClN5O2/c1-33-18-10-7-15(8-11-18)21-14-22(32)29-24(28-21)31-25-27-20-12-9-17(26)13-19(20)23(30-25)16-5-3-2-4-6-16/h2-14H,1H3,(H2,27,28,29,30,31,32) |
| InChIKey | RHYJGYPAAWLSEA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |