C18H19N3 — CID 102212163
4-(4,6-dimethylquinazolin-2-yl)-N,N-dimethylaniline (PubChem CID 102212163) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-(4,6-dimethylquinazolin-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(4,6-dimethylquinazolin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102212163 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4-(4,6-dimethylquinazolin-2-yl)-N,N-dimethylaniline |
| SMILES | Cc1ccc2nc(-c3ccc(N(C)C)cc3)nc(C)c2c1 |
| InChI | InChI=1S/C18H19N3/c1-12-5-10-17-16(11-12)13(2)19-18(20-17)14-6-8-15(9-7-14)21(3)4/h5-11H,1-4H3 |
| InChIKey | RSFCZOXPCPRHLP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |