C19H21N3 — CID 50923303
1-N-(3,7-dimethylquinolin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 50923303) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-N-(3,7-dimethylquinolin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-(3,7-dimethylquinolin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 50923303 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-N-(3,7-dimethylquinolin-2-yl)-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | Cc1ccc2cc(C)c(Nc3ccc(N(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C19H21N3/c1-13-5-6-15-12-14(2)19(21-18(15)11-13)20-16-7-9-17(10-8-16)22(3)4/h5-12H,1-4H3,(H,20,21) |
| InChIKey | RTYNYUXKRYWKHC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|