C23H17ClN6O5 — CID 4729173
N-(2-chloro-4,6-dinitrophenyl)-2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetamide (PubChem CID 4729173) has the molecular formula C23H17ClN6O5 and a molecular weight of 492.88 g/mol. Its IUPAC name is N-(2-chloro-4,6-dinitrophenyl)-2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetamide.
| Compound Name | N-(2-chloro-4,6-dinitrophenyl)-2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 4729173 |
| Molecular Formula | C23H17ClN6O5 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-(2-chloro-4,6-dinitrophenyl)-2-[(6-methyl-4-phenylquinazolin-2-yl)amino]acetamide |
| SMILES | Cc1ccc2nc(NCC(=O)Nc3c(Cl)cc([N+](=O)[O-])cc3[N+](=O)[O-])nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H17ClN6O5/c1-13-7-8-18-16(9-13)21(14-5-3-2-4-6-14)28-23(26-18)25-12-20(31)27-22-17(24)10-15(29(32)33)11-19(22)30(34)35/h2-11H,12H2,1H3,(H,27,31)(H,25,26,28) |
| InChIKey | QLJYRFPBASLFMF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|