C23H17N4O4- — CID 2056663
(3R)-3-[(6-nitro-4-phenylquinazolin-2-yl)amino]-3-phenylpropanoate (PubChem CID 2056663) has the molecular formula C23H17N4O4- and a molecular weight of 413.41 g/mol. Its IUPAC name is (3R)-3-[(6-nitro-4-phenylquinazolin-2-yl)amino]-3-phenylpropanoate.
| Compound Name | (3R)-3-[(6-nitro-4-phenylquinazolin-2-yl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 2056663 |
| Molecular Formula | C23H17N4O4- |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (3R)-3-[(6-nitro-4-phenylquinazolin-2-yl)amino]-3-phenylpropanoate |
| SMILES | O=C([O-])C[C@@H](Nc1nc(-c2ccccc2)c2cc([N+](=O)[O-])ccc2n1)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O4/c28-21(29)14-20(15-7-3-1-4-8-15)25-23-24-19-12-11-17(27(30)31)13-18(19)22(26-23)16-9-5-2-6-10-16/h1-13,20H,14H2,(H,28,29)(H,24,25,26)/p-1/t20-/m1/s1 |
| InChIKey | RWOMTKFEFCKWPY-HXUWFJFHSA-M |
| XLogP | 3.50 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|