C19H15N4O4- — CID 4755551
1-(6-nitro-4-phenylquinazolin-2-yl)pyrrolidine-2-carboxylate (PubChem CID 4755551) has the molecular formula C19H15N4O4- and a molecular weight of 363.35 g/mol. Its IUPAC name is 1-(6-nitro-4-phenylquinazolin-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | 1-(6-nitro-4-phenylquinazolin-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 4755551 |
| Molecular Formula | C19H15N4O4- |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-(6-nitro-4-phenylquinazolin-2-yl)pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])C1CCCN1c1nc(-c2ccccc2)c2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C19H16N4O4/c24-18(25)16-7-4-10-22(16)19-20-15-9-8-13(23(26)27)11-14(15)17(21-19)12-5-2-1-3-6-12/h1-3,5-6,8-9,11,16H,4,7,10H2,(H,24,25)/p-1 |
| InChIKey | KHZHXXAKYKPGCN-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 112.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|