C15H16ClN3O7 — CID 4729208
2-[1-[2-(2-chloro-4,6-dinitroanilino)-2-oxoethyl]cyclopentyl]acetic acid (PubChem CID 4729208) has the molecular formula C15H16ClN3O7 and a molecular weight of 385.76 g/mol. Its IUPAC name is 2-[1-[2-(2-chloro-4,6-dinitroanilino)-2-oxoethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-(2-chloro-4,6-dinitroanilino)-2-oxoethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 4729208 |
| Molecular Formula | C15H16ClN3O7 |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[1-[2-(2-chloro-4,6-dinitroanilino)-2-oxoethyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)Nc2c(Cl)cc([N+](=O)[O-])cc2[N+](=O)[O-])CCCC1 |
| InChI | InChI=1S/C15H16ClN3O7/c16-10-5-9(18(23)24)6-11(19(25)26)14(10)17-12(20)7-15(8-13(21)22)3-1-2-4-15/h5-6H,1-4,7-8H2,(H,17,20)(H,21,22) |
| InChIKey | DGCLMQMYICGWKS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|