C17H22N2O6 — CID 4080153
2-[1-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 4080153) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[1-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 4080153 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[1-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C17H22N2O6/c1-25-14-9-12(19(23)24)5-6-13(14)18-15(20)10-17(11-16(21)22)7-3-2-4-8-17/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | IFZBXUYOJDWVJF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|