C17H20N2O6 — CID 7381302
(4R)-N-(2-methoxy-4-nitrophenyl)-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide (PubChem CID 7381302) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is (4R)-N-(2-methoxy-4-nitrophenyl)-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide.
| Compound Name | (4R)-N-(2-methoxy-4-nitrophenyl)-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 7381302 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (4R)-N-(2-methoxy-4-nitrophenyl)-2-oxo-1-oxaspiro[4.5]decane-4-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H]1CC(=O)OC12CCCCC2 |
| InChI | InChI=1S/C17H20N2O6/c1-24-14-9-11(19(22)23)5-6-13(14)18-16(21)12-10-15(20)25-17(12)7-3-2-4-8-17/h5-6,9,12H,2-4,7-8,10H2,1H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | LCZASDAFYIJYLA-LBPRGKRZSA-N |
| XLogP | 2.81 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|