C25H24N4O4 — CID 3339295
3,4,5-trimethoxy-N'-(6-methyl-4-phenylquinazolin-2-yl)benzohydrazide (PubChem CID 3339295) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N'-(6-methyl-4-phenylquinazolin-2-yl)benzohydrazide.
| Compound Name | 3,4,5-trimethoxy-N'-(6-methyl-4-phenylquinazolin-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 3339295 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3,4,5-trimethoxy-N'-(6-methyl-4-phenylquinazolin-2-yl)benzohydrazide |
| SMILES | COc1cc(C(=O)NNc2nc(-c3ccccc3)c3cc(C)ccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N4O4/c1-15-10-11-19-18(12-15)22(16-8-6-5-7-9-16)27-25(26-19)29-28-24(30)17-13-20(31-2)23(33-4)21(14-17)32-3/h5-14H,1-4H3,(H,28,30)(H,26,27,29) |
| InChIKey | QPEDGDISHWJIGM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|