C15H17ClN4O3 — CID 26120040
3-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-4,5-dimethoxybenzohydrazide (PubChem CID 26120040) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is 3-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-4,5-dimethoxybenzohydrazide.
| Compound Name | 3-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-4,5-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 26120040 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-chloro-N'-(4,6-dimethylpyrimidin-2-yl)-4,5-dimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNc2nc(C)cc(C)n2)cc(Cl)c1OC |
| InChI | InChI=1S/C15H17ClN4O3/c1-8-5-9(2)18-15(17-8)20-19-14(21)10-6-11(16)13(23-4)12(7-10)22-3/h5-7H,1-4H3,(H,19,21)(H,17,18,20) |
| InChIKey | YABYPOKSQULFDH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|