C12H13ClN4O3 — CID 78927573
3-chloro-4,5-dimethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 78927573) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 78927573 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | COc1cc(C(=O)Nc2n[nH]c(C)n2)cc(Cl)c1OC |
| InChI | InChI=1S/C12H13ClN4O3/c1-6-14-12(17-16-6)15-11(18)7-4-8(13)10(20-3)9(5-7)19-2/h4-5H,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | JNEVAIJLIXWJKN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |