C14H18N4O3 — CID 78928120
3,4-diethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 78928120) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3,4-diethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide.
| Compound Name | 3,4-diethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 78928120 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3,4-diethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2n[nH]c(C)n2)cc1OCC |
| InChI | InChI=1S/C14H18N4O3/c1-4-20-11-7-6-10(8-12(11)21-5-2)13(19)16-14-15-9(3)17-18-14/h6-8H,4-5H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | LYGXUXCYTONREV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |