C11H10ClN3O3S — CID 46525451
3-chloro-4,5-dimethoxy-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 46525451) has the molecular formula C11H10ClN3O3S and a molecular weight of 299.74 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46525451 |
| Molecular Formula | C11H10ClN3O3S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | COc1cc(C(=O)Nc2nncs2)cc(Cl)c1OC |
| InChI | InChI=1S/C11H10ClN3O3S/c1-17-8-4-6(3-7(12)9(8)18-2)10(16)14-11-15-13-5-19-11/h3-5H,1-2H3,(H,14,15,16) |
| InChIKey | AQYYFLJPPQLFQZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |