C15H16ClN5O5 — CID 55619349
2-[2-chloro-6-methoxy-4-[[(4-methoxypyrimidin-2-yl)amino]carbamoyl]phenoxy]acetamide (PubChem CID 55619349) has the molecular formula C15H16ClN5O5 and a molecular weight of 381.78 g/mol. Its IUPAC name is 2-[2-chloro-6-methoxy-4-[[(4-methoxypyrimidin-2-yl)amino]carbamoyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-methoxy-4-[[(4-methoxypyrimidin-2-yl)amino]carbamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 55619349 |
| Molecular Formula | C15H16ClN5O5 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[2-chloro-6-methoxy-4-[[(4-methoxypyrimidin-2-yl)amino]carbamoyl]phenoxy]acetamide |
| SMILES | COc1ccnc(NNC(=O)c2cc(Cl)c(OCC(N)=O)c(OC)c2)n1 |
| InChI | InChI=1S/C15H16ClN5O5/c1-24-10-6-8(5-9(16)13(10)26-7-11(17)22)14(23)20-21-15-18-4-3-12(19-15)25-2/h3-6H,7H2,1-2H3,(H2,17,22)(H,20,23)(H,18,19,21) |
| InChIKey | YDYDHLLCPLDOMB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|