C22H17BrN4O — CID 4032991
N'-(6-bromo-4-phenylquinazolin-2-yl)-3-methylbenzohydrazide (PubChem CID 4032991) has the molecular formula C22H17BrN4O and a molecular weight of 433.31 g/mol. Its IUPAC name is N'-(6-bromo-4-phenylquinazolin-2-yl)-3-methylbenzohydrazide.
| Compound Name | N'-(6-bromo-4-phenylquinazolin-2-yl)-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 4032991 |
| Molecular Formula | C22H17BrN4O |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N'-(6-bromo-4-phenylquinazolin-2-yl)-3-methylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)NNc2nc(-c3ccccc3)c3cc(Br)ccc3n2)c1 |
| InChI | InChI=1S/C22H17BrN4O/c1-14-6-5-9-16(12-14)21(28)26-27-22-24-19-11-10-17(23)13-18(19)20(25-22)15-7-3-2-4-8-15/h2-13H,1H3,(H,26,28)(H,24,25,27) |
| InChIKey | LIMUBNNHNFXXRT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|