C16H12BrClN4O — CID 4535582
N'-[6-bromo-4-(2-chlorophenyl)quinazolin-2-yl]acetohydrazide (PubChem CID 4535582) has the molecular formula C16H12BrClN4O and a molecular weight of 391.66 g/mol. Its IUPAC name is N'-[6-bromo-4-(2-chlorophenyl)quinazolin-2-yl]acetohydrazide.
| Compound Name | N'-[6-bromo-4-(2-chlorophenyl)quinazolin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 4535582 |
| Molecular Formula | C16H12BrClN4O |
| Molecular Weight | 391.66 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | N'-[6-bromo-4-(2-chlorophenyl)quinazolin-2-yl]acetohydrazide |
| SMILES | CC(=O)NNc1nc(-c2ccccc2Cl)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C16H12BrClN4O/c1-9(23)21-22-16-19-14-7-6-10(17)8-12(14)15(20-16)11-4-2-3-5-13(11)18/h2-8H,1H3,(H,21,23)(H,19,20,22) |
| InChIKey | YQVNYHSRUGPXPX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|