C14H7Cl3N2 — CID 13033156
2,6-dichloro-4-(2-chlorophenyl)quinazoline (PubChem CID 13033156) has the molecular formula C14H7Cl3N2 and a molecular weight of 309.58 g/mol. Its IUPAC name is 2,6-dichloro-4-(2-chlorophenyl)quinazoline.
| Compound Name | 2,6-dichloro-4-(2-chlorophenyl)quinazoline |
|---|---|
| PubChem CID | 13033156 |
| Molecular Formula | C14H7Cl3N2 |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 2,6-dichloro-4-(2-chlorophenyl)quinazoline |
| SMILES | Clc1ccc2nc(Cl)nc(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C14H7Cl3N2/c15-8-5-6-12-10(7-8)13(19-14(17)18-12)9-3-1-2-4-11(9)16/h1-7H |
| InChIKey | MCSRECZYDQTJSD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |