C12H11Cl2N3 — CID 114692901
2,6-dichloro-4-pyrrolidin-1-ylquinazoline (PubChem CID 114692901) has the molecular formula C12H11Cl2N3 and a molecular weight of 268.15 g/mol. Its IUPAC name is 2,6-dichloro-4-pyrrolidin-1-ylquinazoline.
| Compound Name | 2,6-dichloro-4-pyrrolidin-1-ylquinazoline |
|---|---|
| PubChem CID | 114692901 |
| Molecular Formula | C12H11Cl2N3 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2,6-dichloro-4-pyrrolidin-1-ylquinazoline |
| SMILES | Clc1ccc2nc(Cl)nc(N3CCCC3)c2c1 |
| InChI | InChI=1S/C12H11Cl2N3/c13-8-3-4-10-9(7-8)11(16-12(14)15-10)17-5-1-2-6-17/h3-4,7H,1-2,5-6H2 |
| InChIKey | SWAZWIWPSPQCED-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |