C20H20ClN5OS — CID 42485107
N-[(6-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)methyl]-2-pyridin-2-ylsulfanylacetamide (PubChem CID 42485107) has the molecular formula C20H20ClN5OS and a molecular weight of 413.93 g/mol. Its IUPAC name is N-[(6-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)methyl]-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-[(6-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)methyl]-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 42485107 |
| Molecular Formula | C20H20ClN5OS |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[(6-chloro-4-pyrrolidin-1-ylquinazolin-2-yl)methyl]-2-pyridin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccccn1)NCc1nc(N2CCCC2)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C20H20ClN5OS/c21-14-6-7-16-15(11-14)20(26-9-3-4-10-26)25-17(24-16)12-23-18(27)13-28-19-5-1-2-8-22-19/h1-2,5-8,11H,3-4,9-10,12-13H2,(H,23,27) |
| InChIKey | WARJIVAKAJBLAS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |