C28H27ClN4O — CID 4688099
1-[4-[4-[6-chloro-2-(2-phenylethyl)quinazolin-4-yl]piperazin-1-yl]phenyl]ethanone (PubChem CID 4688099) has the molecular formula C28H27ClN4O and a molecular weight of 471.00 g/mol. Its IUPAC name is 1-[4-[4-[6-chloro-2-(2-phenylethyl)quinazolin-4-yl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[6-chloro-2-(2-phenylethyl)quinazolin-4-yl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 4688099 |
| Molecular Formula | C28H27ClN4O |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 1-[4-[4-[6-chloro-2-(2-phenylethyl)quinazolin-4-yl]piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(c3nc(CCc4ccccc4)nc4ccc(Cl)cc34)CC2)cc1 |
| InChI | InChI=1S/C28H27ClN4O/c1-20(34)22-8-11-24(12-9-22)32-15-17-33(18-16-32)28-25-19-23(29)10-13-26(25)30-27(31-28)14-7-21-5-3-2-4-6-21/h2-6,8-13,19H,7,14-18H2,1H3 |
| InChIKey | BRLHTFMIUANNDM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |