C17H20N4O2S — CID 40658340
(2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone (PubChem CID 40658340) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone.
| Compound Name | (2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone |
|---|---|
| PubChem CID | 40658340 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-morpholin-4-yl-2-phenylethanone |
| SMILES | Cc1cc(N)nc(S[C@H](C(=O)N2CCOCC2)c2ccccc2)n1 |
| InChI | InChI=1S/C17H20N4O2S/c1-12-11-14(18)20-17(19-12)24-15(13-5-3-2-4-6-13)16(22)21-7-9-23-10-8-21/h2-6,11,15H,7-10H2,1H3,(H2,18,19,20)/t15-/m0/s1 |
| InChIKey | ZYGHXRSBNMYQRA-HNNXBMFYSA-N |
| XLogP | 2.06 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |