C12H11BrN4OS — CID 136931735
2-bromo-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide (PubChem CID 136931735) has the molecular formula C12H11BrN4OS and a molecular weight of 339.22 g/mol. Its IUPAC name is 2-bromo-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 2-bromo-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 136931735 |
| Molecular Formula | C12H11BrN4OS |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 2-bromo-6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Br)cccc1Sc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H11BrN4OS/c1-6-5-9(18)17-12(16-6)19-8-4-2-3-7(13)10(8)11(14)15/h2-5H,1H3,(H3,14,15)(H,16,17,18) |
| InChIKey | WAKKEJOOKAGJDQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|