C8H6FN5O2S — CID 105382751
3-fluoro-2-(1-methyltetrazol-5-yl)sulfanylpyridine-4-carboxylic acid (PubChem CID 105382751) has the molecular formula C8H6FN5O2S and a molecular weight of 255.23 g/mol. Its IUPAC name is 3-fluoro-2-(1-methyltetrazol-5-yl)sulfanylpyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-(1-methyltetrazol-5-yl)sulfanylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105382751 |
| Molecular Formula | C8H6FN5O2S |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 3-fluoro-2-(1-methyltetrazol-5-yl)sulfanylpyridine-4-carboxylic acid |
| SMILES | Cn1nnnc1Sc1nccc(C(=O)O)c1F |
| InChI | InChI=1S/C8H6FN5O2S/c1-14-8(11-12-13-14)17-6-5(9)4(7(15)16)2-3-10-6/h2-3H,1H3,(H,15,16) |
| InChIKey | JNMYSBNHWCUEDZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |