C10H7FN4O4S — CID 107786190
3-(3-fluoro-5-nitrophenyl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786190) has the molecular formula C10H7FN4O4S and a molecular weight of 298.26 g/mol. Its IUPAC name is 3-(3-fluoro-5-nitrophenyl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(3-fluoro-5-nitrophenyl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786190 |
| Molecular Formula | C10H7FN4O4S |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 3-(3-fluoro-5-nitrophenyl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7FN4O4S/c1-14-10(12-8(16)9(17)13-14)20-7-3-5(11)2-6(4-7)15(18)19/h2-4H,1H3,(H,13,17) |
| InChIKey | PLTQIYSBOULVMR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|