C8H4FN3O2S2 — CID 80747907
2-(3-fluoro-5-nitrophenyl)sulfanyl-1,3,4-thiadiazole (PubChem CID 80747907) has the molecular formula C8H4FN3O2S2 and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-(3-fluoro-5-nitrophenyl)sulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-(3-fluoro-5-nitrophenyl)sulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80747907 |
| Molecular Formula | C8H4FN3O2S2 |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 2-(3-fluoro-5-nitrophenyl)sulfanyl-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1cc(F)cc(Sc2nncs2)c1 |
| InChI | InChI=1S/C8H4FN3O2S2/c9-5-1-6(12(13)14)3-7(2-5)16-8-11-10-4-15-8/h1-4H |
| InChIKey | YLAJHAOGSSGWRJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|