C15H12FNO2S — CID 80752960
5-(3-fluoro-5-nitrophenyl)sulfanyl-2,3-dihydro-1H-indene (PubChem CID 80752960) has the molecular formula C15H12FNO2S and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-(3-fluoro-5-nitrophenyl)sulfanyl-2,3-dihydro-1H-indene.
| Compound Name | 5-(3-fluoro-5-nitrophenyl)sulfanyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 80752960 |
| Molecular Formula | C15H12FNO2S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-(3-fluoro-5-nitrophenyl)sulfanyl-2,3-dihydro-1H-indene |
| SMILES | O=[N+]([O-])c1cc(F)cc(Sc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C15H12FNO2S/c16-12-7-13(17(18)19)9-15(8-12)20-14-5-4-10-2-1-3-11(10)6-14/h4-9H,1-3H2 |
| InChIKey | MHJLYINGYVDIHI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|