C11H10FN3O3S — CID 107783563
3-[3-fluoro-5-(hydroxymethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107783563) has the molecular formula C11H10FN3O3S and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-[3-fluoro-5-(hydroxymethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[3-fluoro-5-(hydroxymethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107783563 |
| Molecular Formula | C11H10FN3O3S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 3-[3-fluoro-5-(hydroxymethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1cc(F)cc(CO)c1 |
| InChI | InChI=1S/C11H10FN3O3S/c1-15-11(13-9(17)10(18)14-15)19-8-3-6(5-16)2-7(12)4-8/h2-4,16H,5H2,1H3,(H,14,18) |
| InChIKey | IRLXYSNTAWCNPV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|