C12H12FN3O3S — CID 107783560
3-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107783560) has the molecular formula C12H12FN3O3S and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107783560 |
| Molecular Formula | C12H12FN3O3S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | C[C@@H](O)c1cc(F)ccc1Sc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C12H12FN3O3S/c1-6(17)8-5-7(13)3-4-9(8)20-12-14-10(18)11(19)15-16(12)2/h3-6,17H,1-2H3,(H,15,19)/t6-/m1/s1 |
| InChIKey | GSMAXIUESBGNKR-ZCFIWIBFSA-N |
| XLogP | 0.81 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|